About [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone
[(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone (PubChem CID 164632953) has the molecular formula C15H23N3O3
and a molecular weight of 293.37 g/mol. Its IUPAC name is [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone.
Molecular Properties
| Compound Name | [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone |
| PubChem CID | 164632953 |
| Molecular Formula | C15H23N3O3 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone |
| SMILES | COc1ncc(C(=O)N2CCO[C@H](C(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C15H23N3O3/c1-15(2,3)12-5-6-18(7-8-21-12)13(19)11-9-16-14(20-4)17-10-11/h9-10,12H,5-8H2,1-4H3/t12-/m0/s1 |
| InChIKey | GZOIENTWLLSBPY-LBPRGKRZSA-N |
| XLogP | 1.76 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone?
The IUPAC name of [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone (CID 164632953) is [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone.
What is the SMILES notation for [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone?
The canonical SMILES for [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone is COc1ncc(C(=O)N2CCO[C@H](C(C)(C)C)CC2)cn1.
What is the InChIKey of [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone?
The InChIKey is GZOIENTWLLSBPY-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H23N3O3/c1-15(2,3)12-5-6-18(7-8-21-12)13(19)11-9-16-14(20-4)17-10-11/h9-10,12H,5-8H2,1-4H3/t12-/m0/s1.
What are the key properties of [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone?
[(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone has a molecular weight of 293.37 g/mol, XLogP of 1.76, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(7S)-7-tert-butyl-1,4-oxazepan-4-yl]-(2-methoxypyrimidin-5-yl)methanone is sourced from PubChem (CID 164632953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).