About 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide
5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide (PubChem CID 164632959) has the molecular formula C9H12F3NO4S
and a molecular weight of 287.26 g/mol. Its IUPAC name is 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide.
Molecular Properties
| Compound Name | 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide |
| PubChem CID | 164632959 |
| Molecular Formula | C9H12F3NO4S |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.04 |
| IUPAC Name | 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CO)CC(F)(F)F)o1 |
| InChI | InChI=1S/C9H12F3NO4S/c1-6-2-3-8(17-6)18(15,16)13-7(5-14)4-9(10,11)12/h2-3,7,13-14H,4-5H2,1H3/t7-/m0/s1 |
| InChIKey | LNJIYWKDHUAZOI-ZETCQYMHSA-N |
| XLogP | 1.18 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide?
The IUPAC name of 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide (CID 164632959) is 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide.
What is the SMILES notation for 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide?
The canonical SMILES for 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide is Cc1ccc(S(=O)(=O)N[C@H](CO)CC(F)(F)F)o1.
What is the InChIKey of 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide?
The InChIKey is LNJIYWKDHUAZOI-ZETCQYMHSA-N. The full InChI is InChI=1S/C9H12F3NO4S/c1-6-2-3-8(17-6)18(15,16)13-7(5-14)4-9(10,11)12/h2-3,7,13-14H,4-5H2,1H3/t7-/m0/s1.
What are the key properties of 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide?
5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide has a molecular weight of 287.26 g/mol, XLogP of 1.18, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-[(2S)-4,4,4-trifluoro-1-hydroxybutan-2-yl]furan-2-sulfonamide is sourced from PubChem (CID 164632959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).