About 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid
2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid (PubChem CID 164633122) has the molecular formula C16H23NO5S
and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid.
Molecular Properties
| Compound Name | 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid |
| PubChem CID | 164633122 |
| Molecular Formula | C16H23NO5S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H]2CC[C@@H](CC(=O)O)C2)c(C)c1 |
| InChI | InChI=1S/C16H23NO5S/c1-3-22-14-6-7-15(11(2)8-14)23(20,21)17-13-5-4-12(9-13)10-16(18)19/h6-8,12-13,17H,3-5,9-10H2,1-2H3,(H,18,19)/t12-,13+/m1/s1 |
| InChIKey | YCEIROLWDIZESD-OLZOCXBDSA-N |
| XLogP | 2.32 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid?
The IUPAC name of 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid (CID 164633122) is 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid.
What is the SMILES notation for 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid?
The canonical SMILES for 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid is CCOc1ccc(S(=O)(=O)N[C@H]2CC[C@@H](CC(=O)O)C2)c(C)c1.
What is the InChIKey of 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid?
The InChIKey is YCEIROLWDIZESD-OLZOCXBDSA-N. The full InChI is InChI=1S/C16H23NO5S/c1-3-22-14-6-7-15(11(2)8-14)23(20,21)17-13-5-4-12(9-13)10-16(18)19/h6-8,12-13,17H,3-5,9-10H2,1-2H3,(H,18,19)/t12-,13+/m1/s1.
What are the key properties of 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid?
2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid has a molecular weight of 341.43 g/mol, XLogP of 2.32, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(1R,3S)-3-[(4-ethoxy-2-methylphenyl)sulfonylamino]cyclopentyl]acetic acid is sourced from PubChem (CID 164633122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).