About (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol
(4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol (PubChem CID 164633158) has the molecular formula C11H19N3O2
and a molecular weight of 225.29 g/mol. Its IUPAC name is (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol.
Molecular Properties
| Compound Name | (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol |
| PubChem CID | 164633158 |
| Molecular Formula | C11H19N3O2 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol |
| SMILES | CCc1nc(CN2CCC[C@H](O)CC2)no1 |
| InChI | InChI=1S/C11H19N3O2/c1-2-11-12-10(13-16-11)8-14-6-3-4-9(15)5-7-14/h9,15H,2-8H2,1H3/t9-/m0/s1 |
| InChIKey | DMKWSZPUDJYUCN-VIFPVBQESA-N |
| XLogP | 0.98 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol?
The IUPAC name of (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol (CID 164633158) is (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol.
What is the SMILES notation for (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol?
The canonical SMILES for (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol is CCc1nc(CN2CCC[C@H](O)CC2)no1.
What is the InChIKey of (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol?
The InChIKey is DMKWSZPUDJYUCN-VIFPVBQESA-N. The full InChI is InChI=1S/C11H19N3O2/c1-2-11-12-10(13-16-11)8-14-6-3-4-9(15)5-7-14/h9,15H,2-8H2,1H3/t9-/m0/s1.
What are the key properties of (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol?
(4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol has a molecular weight of 225.29 g/mol, XLogP of 0.98, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-[(5-ethyl-1,2,4-oxadiazol-3-yl)methyl]azepan-4-ol is sourced from PubChem (CID 164633158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).