About (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one
(5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one (PubChem CID 164633273) has the molecular formula C14H15N3OS
and a molecular weight of 273.36 g/mol. Its IUPAC name is (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one.
Molecular Properties
| Compound Name | (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one |
| PubChem CID | 164633273 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one |
| SMILES | O=C1CN(Cc2ccns2)[C@H](c2ccccc2)CN1 |
| InChI | InChI=1S/C14H15N3OS/c18-14-10-17(9-12-6-7-16-19-12)13(8-15-14)11-4-2-1-3-5-11/h1-7,13H,8-10H2,(H,15,18)/t13-/m0/s1 |
| InChIKey | FSZARWODLHACKG-ZDUSSCGKSA-N |
| XLogP | 1.82 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one?
The IUPAC name of (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one (CID 164633273) is (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one.
What is the SMILES notation for (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one?
The canonical SMILES for (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one is O=C1CN(Cc2ccns2)[C@H](c2ccccc2)CN1.
What is the InChIKey of (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one?
The InChIKey is FSZARWODLHACKG-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H15N3OS/c18-14-10-17(9-12-6-7-16-19-12)13(8-15-14)11-4-2-1-3-5-11/h1-7,13H,8-10H2,(H,15,18)/t13-/m0/s1.
What are the key properties of (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one?
(5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one has a molecular weight of 273.36 g/mol, XLogP of 1.82, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5-phenyl-4-(1,2-thiazol-5-ylmethyl)piperazin-2-one is sourced from PubChem (CID 164633273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).