C15H15Cl2N5O2 — CID 164633305
(5R)-5-(3,4-dichlorophenyl)-3-[(3-ethyltriazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 164633305) has the molecular formula C15H15Cl2N5O2 and a molecular weight of 368.22 g/mol. Its IUPAC name is (5R)-5-(3,4-dichlorophenyl)-3-[(3-ethyltriazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(3,4-dichlorophenyl)-3-[(3-ethyltriazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 164633305 |
| Molecular Formula | C15H15Cl2N5O2 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | (5R)-5-(3,4-dichlorophenyl)-3-[(3-ethyltriazol-4-yl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCn1nncc1CN1C(=O)N[C@](C)(c2ccc(Cl)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H15Cl2N5O2/c1-3-22-10(7-18-20-22)8-21-13(23)15(2,19-14(21)24)9-4-5-11(16)12(17)6-9/h4-7H,3,8H2,1-2H3,(H,19,24)/t15-/m1/s1 |
| InChIKey | YTJRURUXRNKVTE-OAHLLOKOSA-N |
| XLogP | 2.57 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|