C34H41ClN4O4 — CID 164633539
(1R,5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-6-N-(4-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 164633539) has the molecular formula C34H41ClN4O4 and a molecular weight of 605.18 g/mol. Its IUPAC name is (1R,5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-6-N-(4-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (1R,5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-6-N-(4-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 164633539 |
| Molecular Formula | C34H41ClN4O4 |
| Molecular Weight | 605.18 g/mol |
| Exact Mass | 604.28 |
| IUPAC Name | (1R,5R,7S)-3-[2-[benzyl(methyl)amino]ethyl]-6-N-(4-chlorophenyl)-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC1CCCC(NC(=O)C2N(CCN(C)Cc3ccccc3)C(=O)[C@@H]3C(C(=O)Nc4ccc(Cl)cc4)[C@@H]4C=C[C@]23O4)C1C |
| InChI | InChI=1S/C34H41ClN4O4/c1-21-8-7-11-26(22(21)2)37-32(41)30-34-17-16-27(43-34)28(31(40)36-25-14-12-24(35)13-15-25)29(34)33(42)39(30)19-18-38(3)20-23-9-5-4-6-10-23/h4-6,9-10,12-17,21-22,26-30H,7-8,11,18-20H2,1-3H3,(H,36,40)(H,37,41)/t21?,22?,26?,27-,28?,29-,30?,34+/m0/s1 |
| InChIKey | BTOXSTGJEGXLRD-KXZCLHMYSA-N |
| XLogP | 4.50 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|