About 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one
1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one (PubChem CID 164633574) has the molecular formula C18H25N5O
and a molecular weight of 327.43 g/mol. Its IUPAC name is 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one.
Molecular Properties
| Compound Name | 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one |
| PubChem CID | 164633574 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one |
| SMILES | CCCC(=O)N1CCCCC[C@H](Nc2ccc3nccnc3n2)C1 |
| InChI | InChI=1S/C18H25N5O/c1-2-6-17(24)23-12-5-3-4-7-14(13-23)21-16-9-8-15-18(22-16)20-11-10-19-15/h8-11,14H,2-7,12-13H2,1H3,(H,20,21,22)/t14-/m0/s1 |
| InChIKey | YOMIYVSIEOKGIW-AWEZNQCLSA-N |
| XLogP | 3.01 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one?
The IUPAC name of 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one (CID 164633574) is 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one.
What is the SMILES notation for 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one?
The canonical SMILES for 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one is CCCC(=O)N1CCCCC[C@H](Nc2ccc3nccnc3n2)C1.
What is the InChIKey of 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one?
The InChIKey is YOMIYVSIEOKGIW-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H25N5O/c1-2-6-17(24)23-12-5-3-4-7-14(13-23)21-16-9-8-15-18(22-16)20-11-10-19-15/h8-11,14H,2-7,12-13H2,1H3,(H,20,21,22)/t14-/m0/s1.
What are the key properties of 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one?
1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one has a molecular weight of 327.43 g/mol, XLogP of 3.01, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S)-3-(pyrido[2,3-b]pyrazin-6-ylamino)azocan-1-yl]butan-1-one is sourced from PubChem (CID 164633574), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).