C21H26N2O3 — CID 164633776
2-[3-[(2S,3R)-2-tert-butyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-one (PubChem CID 164633776) has the molecular formula C21H26N2O3 and a molecular weight of 354.45 g/mol. Its IUPAC name is 2-[3-[(2S,3R)-2-tert-butyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-one.
| Compound Name | 2-[3-[(2S,3R)-2-tert-butyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
|---|---|
| PubChem CID | 164633776 |
| Molecular Formula | C21H26N2O3 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 2-[3-[(2S,3R)-2-tert-butyloxolan-3-yl]-1,2,4-oxadiazol-5-yl]-6,7,8,9-tetrahydrobenzo[7]annulen-5-one |
| SMILES | CC(C)(C)[C@H]1OCC[C@@H]1c1noc(-c2ccc3c(c2)CCCCC3=O)n1 |
| InChI | InChI=1S/C21H26N2O3/c1-21(2,3)18-16(10-11-25-18)19-22-20(26-23-19)14-8-9-15-13(12-14)6-4-5-7-17(15)24/h8-9,12,16,18H,4-7,10-11H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | RZAOUINFANULNH-WMZOPIPTSA-N |
| XLogP | 4.56 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |