C15H16F3N3O — CID 164633867
N-[(3S)-3-phenylbutyl]-5-(trifluoromethyl)-1H-imidazole-4-carboxamide (PubChem CID 164633867) has the molecular formula C15H16F3N3O and a molecular weight of 311.31 g/mol. Its IUPAC name is N-[(3S)-3-phenylbutyl]-5-(trifluoromethyl)-1H-imidazole-4-carboxamide.
| Compound Name | N-[(3S)-3-phenylbutyl]-5-(trifluoromethyl)-1H-imidazole-4-carboxamide |
|---|---|
| PubChem CID | 164633867 |
| Molecular Formula | C15H16F3N3O |
| Molecular Weight | 311.31 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | N-[(3S)-3-phenylbutyl]-5-(trifluoromethyl)-1H-imidazole-4-carboxamide |
| SMILES | C[C@@H](CCNC(=O)c1nc[nH]c1C(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C15H16F3N3O/c1-10(11-5-3-2-4-6-11)7-8-19-14(22)12-13(15(16,17)18)21-9-20-12/h2-6,9-10H,7-8H2,1H3,(H,19,22)(H,20,21)/t10-/m0/s1 |
| InChIKey | WOFLWPNLBZWOOL-JTQLQIEISA-N |
| XLogP | 3.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.31 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |