C14H23N5O2 — CID 164633933
1-(3-ethyl-1-methylpyrazol-4-yl)-3-[2-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]ethyl]urea (PubChem CID 164633933) has the molecular formula C14H23N5O2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 1-(3-ethyl-1-methylpyrazol-4-yl)-3-[2-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]ethyl]urea.
| Compound Name | 1-(3-ethyl-1-methylpyrazol-4-yl)-3-[2-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]ethyl]urea |
|---|---|
| PubChem CID | 164633933 |
| Molecular Formula | C14H23N5O2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | 1-(3-ethyl-1-methylpyrazol-4-yl)-3-[2-[(3S)-1-methyl-5-oxopyrrolidin-3-yl]ethyl]urea |
| SMILES | CCc1nn(C)cc1NC(=O)NCC[C@H]1CC(=O)N(C)C1 |
| InChI | InChI=1S/C14H23N5O2/c1-4-11-12(9-19(3)17-11)16-14(21)15-6-5-10-7-13(20)18(2)8-10/h9-10H,4-8H2,1-3H3,(H2,15,16,21)/t10-/m0/s1 |
| InChIKey | SULOUKHHSUDRCA-JTQLQIEISA-N |
| XLogP | 0.97 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |