C16H18F3NO3S — CID 164634060
2-[(3R)-1,1-dioxothian-3-yl]-1-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone (PubChem CID 164634060) has the molecular formula C16H18F3NO3S and a molecular weight of 361.39 g/mol. Its IUPAC name is 2-[(3R)-1,1-dioxothian-3-yl]-1-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone.
| Compound Name | 2-[(3R)-1,1-dioxothian-3-yl]-1-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
|---|---|
| PubChem CID | 164634060 |
| Molecular Formula | C16H18F3NO3S |
| Molecular Weight | 361.39 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 2-[(3R)-1,1-dioxothian-3-yl]-1-(5,6,8-trifluoro-3,4-dihydro-2H-quinolin-1-yl)ethanone |
| SMILES | O=C(C[C@H]1CCCS(=O)(=O)C1)N1CCCc2c(F)c(F)cc(F)c21 |
| InChI | InChI=1S/C16H18F3NO3S/c17-12-8-13(18)16-11(15(12)19)4-1-5-20(16)14(21)7-10-3-2-6-24(22,23)9-10/h8,10H,1-7,9H2/t10-/m1/s1 |
| InChIKey | OGPJRAXOUOAFIQ-SNVBAGLBSA-N |
| XLogP | 2.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|