C16H24N6O — CID 164634112
2-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-[(7S)-3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]acetamide (PubChem CID 164634112) has the molecular formula C16H24N6O and a molecular weight of 316.41 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-[(7S)-3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]acetamide.
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-[(7S)-3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]acetamide |
|---|---|
| PubChem CID | 164634112 |
| Molecular Formula | C16H24N6O |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-methyl-N-[(7S)-3-methyl-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-7-yl]acetamide |
| SMILES | Cc1cc(C)n(CC(=O)N(C)[C@H]2CCc3nnc(C)n3CC2)n1 |
| InChI | InChI=1S/C16H24N6O/c1-11-9-12(2)22(19-11)10-16(23)20(4)14-5-6-15-18-17-13(3)21(15)8-7-14/h9,14H,5-8,10H2,1-4H3/t14-/m0/s1 |
| InChIKey | FJVLZKVRBSQXOY-AWEZNQCLSA-N |
| XLogP | 1.26 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |