C18H30N4O3S — CID 164634228
1-[(4aR,7aS)-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one (PubChem CID 164634228) has the molecular formula C18H30N4O3S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[(4aR,7aS)-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one.
| Compound Name | 1-[(4aR,7aS)-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one |
|---|---|
| PubChem CID | 164634228 |
| Molecular Formula | C18H30N4O3S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | 1-[(4aR,7aS)-1-[(1-ethyl-5-methylpyrazol-4-yl)methyl]-6,6-dioxo-2,3,4a,5,7,7a-hexahydrothieno[3,4-b]pyrazin-4-yl]-3-methylbutan-1-one |
| SMILES | CCn1ncc(CN2CCN(C(=O)CC(C)C)[C@H]3CS(=O)(=O)C[C@H]32)c1C |
| InChI | InChI=1S/C18H30N4O3S/c1-5-22-14(4)15(9-19-22)10-20-6-7-21(18(23)8-13(2)3)17-12-26(24,25)11-16(17)20/h9,13,16-17H,5-8,10-12H2,1-4H3/t16-,17+/m1/s1 |
| InChIKey | CIGXYCUSQVSOBD-SJORKVTESA-N |
| XLogP | 1.07 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |