About N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide
N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide (PubChem CID 164634296) has the molecular formula C10H14F2N2O
and a molecular weight of 216.23 g/mol. Its IUPAC name is N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide.
Molecular Properties
| Compound Name | N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide |
| PubChem CID | 164634296 |
| Molecular Formula | C10H14F2N2O |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide |
| SMILES | CC(F)(F)CC(=O)N[C@H]1CC[C@@H](C#N)C1 |
| InChI | InChI=1S/C10H14F2N2O/c1-10(11,12)5-9(15)14-8-3-2-7(4-8)6-13/h7-8H,2-5H2,1H3,(H,14,15)/t7-,8+/m1/s1 |
| InChIKey | UKLPTPLJXLSPLJ-SFYZADRCSA-N |
| XLogP | 1.84 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide?
The IUPAC name of N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide (CID 164634296) is N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide.
What is the SMILES notation for N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide?
The canonical SMILES for N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide is CC(F)(F)CC(=O)N[C@H]1CC[C@@H](C#N)C1.
What is the InChIKey of N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide?
The InChIKey is UKLPTPLJXLSPLJ-SFYZADRCSA-N. The full InChI is InChI=1S/C10H14F2N2O/c1-10(11,12)5-9(15)14-8-3-2-7(4-8)6-13/h7-8H,2-5H2,1H3,(H,14,15)/t7-,8+/m1/s1.
What are the key properties of N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide?
N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide has a molecular weight of 216.23 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S,3R)-3-cyanocyclopentyl]-3,3-difluorobutanamide is sourced from PubChem (CID 164634296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).