About 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide
2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide (PubChem CID 164634443) has the molecular formula C14H17N3O4
and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide |
| PubChem CID | 164634443 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide |
| SMILES | O=C1CC[C@H](NC(=O)c2coc(C3CCCC3)n2)C(=O)N1 |
| InChI | InChI=1S/C14H17N3O4/c18-11-6-5-9(12(19)17-11)15-13(20)10-7-21-14(16-10)8-3-1-2-4-8/h7-9H,1-6H2,(H,15,20)(H,17,18,19)/t9-/m0/s1 |
| InChIKey | CUCDCJWABJPICZ-VIFPVBQESA-N |
| XLogP | 0.87 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide?
The IUPAC name of 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide (CID 164634443) is 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide.
What is the SMILES notation for 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide?
The canonical SMILES for 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide is O=C1CC[C@H](NC(=O)c2coc(C3CCCC3)n2)C(=O)N1.
What is the InChIKey of 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide?
The InChIKey is CUCDCJWABJPICZ-VIFPVBQESA-N. The full InChI is InChI=1S/C14H17N3O4/c18-11-6-5-9(12(19)17-11)15-13(20)10-7-21-14(16-10)8-3-1-2-4-8/h7-9H,1-6H2,(H,15,20)(H,17,18,19)/t9-/m0/s1.
What are the key properties of 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide?
2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide has a molecular weight of 291.31 g/mol, XLogP of 0.87, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-N-[(3S)-2,6-dioxopiperidin-3-yl]-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 164634443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).