About 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea
1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea (PubChem CID 164634536) has the molecular formula C12H15N5OS
and a molecular weight of 277.35 g/mol. Its IUPAC name is 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea.
Molecular Properties
| Compound Name | 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea |
| PubChem CID | 164634536 |
| Molecular Formula | C12H15N5OS |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.10 |
| IUPAC Name | 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea |
| SMILES | Cc1cnc([C@H](C)NC(=O)NCc2cnccn2)s1 |
| InChI | InChI=1S/C12H15N5OS/c1-8-5-15-11(19-8)9(2)17-12(18)16-7-10-6-13-3-4-14-10/h3-6,9H,7H2,1-2H3,(H2,16,17,18)/t9-/m0/s1 |
| InChIKey | YWFKEDAZPLMQOL-VIFPVBQESA-N |
| XLogP | 1.80 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea?
The IUPAC name of 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea (CID 164634536) is 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea.
What is the SMILES notation for 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea?
The canonical SMILES for 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea is Cc1cnc([C@H](C)NC(=O)NCc2cnccn2)s1.
What is the InChIKey of 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea?
The InChIKey is YWFKEDAZPLMQOL-VIFPVBQESA-N. The full InChI is InChI=1S/C12H15N5OS/c1-8-5-15-11(19-8)9(2)17-12(18)16-7-10-6-13-3-4-14-10/h3-6,9H,7H2,1-2H3,(H2,16,17,18)/t9-/m0/s1.
What are the key properties of 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea?
1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea has a molecular weight of 277.35 g/mol, XLogP of 1.80, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S)-1-(5-methyl-1,3-thiazol-2-yl)ethyl]-3-(pyrazin-2-ylmethyl)urea is sourced from PubChem (CID 164634536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).