C17H22ClN3O3 — CID 164634633
(4aR,8aS)-6-(5-chloro-6-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 164634633) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is (4aR,8aS)-6-(5-chloro-6-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-(5-chloro-6-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 164634633 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (4aR,8aS)-6-(5-chloro-6-oxo-1H-pyridine-3-carbonyl)-1-propyl-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CCCN1C(=O)CC[C@@H]2CN(C(=O)c3c[nH]c(=O)c(Cl)c3)CC[C@@H]21 |
| InChI | InChI=1S/C17H22ClN3O3/c1-2-6-21-14-5-7-20(10-11(14)3-4-15(21)22)17(24)12-8-13(18)16(23)19-9-12/h8-9,11,14H,2-7,10H2,1H3,(H,19,23)/t11-,14+/m1/s1 |
| InChIKey | CUHOSCBANMRLNA-RISCZKNCSA-N |
| XLogP | 1.89 |
| TPSA | 73.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |