C15H18N4O4S — CID 164634891
1-methyl-N-[(1S)-1-methylcyclohex-3-en-1-yl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonamide (PubChem CID 164634891) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 1-methyl-N-[(1S)-1-methylcyclohex-3-en-1-yl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonamide.
| Compound Name | 1-methyl-N-[(1S)-1-methylcyclohex-3-en-1-yl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonamide |
|---|---|
| PubChem CID | 164634891 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-methyl-N-[(1S)-1-methylcyclohex-3-en-1-yl]-2,4-dioxopyrido[2,3-d]pyrimidine-6-sulfonamide |
| SMILES | Cn1c(=O)[nH]c(=O)c2cc(S(=O)(=O)N[C@]3(C)CC=CCC3)cnc21 |
| InChI | InChI=1S/C15H18N4O4S/c1-15(6-4-3-5-7-15)18-24(22,23)10-8-11-12(16-9-10)19(2)14(21)17-13(11)20/h3-4,8-9,18H,5-7H2,1-2H3,(H,17,20,21)/t15-/m1/s1 |
| InChIKey | RKVBVHVXYUJZDV-OAHLLOKOSA-N |
| XLogP | 0.40 |
| TPSA | 113.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|