About N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide
N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide (PubChem CID 164634958) has the molecular formula C12H21N3O2S2
and a molecular weight of 303.45 g/mol. Its IUPAC name is N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide.
Molecular Properties
| Compound Name | N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide |
| PubChem CID | 164634958 |
| Molecular Formula | C12H21N3O2S2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1csc(S(=O)(=O)NC[C@H]2CN(C)CCN2C)c1 |
| InChI | InChI=1S/C12H21N3O2S2/c1-10-6-12(18-9-10)19(16,17)13-7-11-8-14(2)4-5-15(11)3/h6,9,11,13H,4-5,7-8H2,1-3H3/t11-/m0/s1 |
| InChIKey | AFHYEVOVANRKRI-NSHDSACASA-N |
| XLogP | 0.58 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide?
The IUPAC name of N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide (CID 164634958) is N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide.
What is the SMILES notation for N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide?
The canonical SMILES for N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide is Cc1csc(S(=O)(=O)NC[C@H]2CN(C)CCN2C)c1.
What is the InChIKey of N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide?
The InChIKey is AFHYEVOVANRKRI-NSHDSACASA-N. The full InChI is InChI=1S/C12H21N3O2S2/c1-10-6-12(18-9-10)19(16,17)13-7-11-8-14(2)4-5-15(11)3/h6,9,11,13H,4-5,7-8H2,1-3H3/t11-/m0/s1.
What are the key properties of N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide?
N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide has a molecular weight of 303.45 g/mol, XLogP of 0.58, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(2R)-1,4-dimethylpiperazin-2-yl]methyl]-4-methylthiophene-2-sulfonamide is sourced from PubChem (CID 164634958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).