C13H20F3N5 — CID 164634981
(6S)-1-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane (PubChem CID 164634981) has the molecular formula C13H20F3N5 and a molecular weight of 303.33 g/mol. Its IUPAC name is (6S)-1-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane.
| Compound Name | (6S)-1-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 164634981 |
| Molecular Formula | C13H20F3N5 |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | (6S)-1-(5,6-dimethyl-1,2,4-triazin-3-yl)-6-methyl-4-(2,2,2-trifluoroethyl)-1,4-diazepane |
| SMILES | Cc1nnc(N2CCN(CC(F)(F)F)C[C@H](C)C2)nc1C |
| InChI | InChI=1S/C13H20F3N5/c1-9-6-20(8-13(14,15)16)4-5-21(7-9)12-17-10(2)11(3)18-19-12/h9H,4-8H2,1-3H3/t9-/m0/s1 |
| InChIKey | WWKNAHXASNPSPH-VIFPVBQESA-N |
| XLogP | 1.81 |
| TPSA | 45.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |