C12H19N3O2S — CID 164635216
N-[[(2R)-1,1-dioxothian-2-yl]methyl]-4,5-dimethylpyrimidin-2-amine (PubChem CID 164635216) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is N-[[(2R)-1,1-dioxothian-2-yl]methyl]-4,5-dimethylpyrimidin-2-amine.
| Compound Name | N-[[(2R)-1,1-dioxothian-2-yl]methyl]-4,5-dimethylpyrimidin-2-amine |
|---|---|
| PubChem CID | 164635216 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | N-[[(2R)-1,1-dioxothian-2-yl]methyl]-4,5-dimethylpyrimidin-2-amine |
| SMILES | Cc1cnc(NC[C@H]2CCCCS2(=O)=O)nc1C |
| InChI | InChI=1S/C12H19N3O2S/c1-9-7-13-12(15-10(9)2)14-8-11-5-3-4-6-18(11,16)17/h7,11H,3-6,8H2,1-2H3,(H,13,14,15)/t11-/m1/s1 |
| InChIKey | PKAUPXWLDZUCSJ-LLVKDONJSA-N |
| XLogP | 1.47 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |