About 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone
1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone (PubChem CID 164635284) has the molecular formula C16H26N4O
and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone.
Molecular Properties
| Compound Name | 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone |
| PubChem CID | 164635284 |
| Molecular Formula | C16H26N4O |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone |
| SMILES | Cn1nccc1[C@@H]1CN(C(=O)CC2CCCCC2)C[C@H]1N |
| InChI | InChI=1S/C16H26N4O/c1-19-15(7-8-18-19)13-10-20(11-14(13)17)16(21)9-12-5-3-2-4-6-12/h7-8,12-14H,2-6,9-11,17H2,1H3/t13-,14-/m1/s1 |
| InChIKey | ONMONRUASCBVLH-ZIAGYGMSSA-N |
| XLogP | 1.64 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone?
The IUPAC name of 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone (CID 164635284) is 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone.
What is the SMILES notation for 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone?
The canonical SMILES for 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone is Cn1nccc1[C@@H]1CN(C(=O)CC2CCCCC2)C[C@H]1N.
What is the InChIKey of 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone?
The InChIKey is ONMONRUASCBVLH-ZIAGYGMSSA-N. The full InChI is InChI=1S/C16H26N4O/c1-19-15(7-8-18-19)13-10-20(11-14(13)17)16(21)9-12-5-3-2-4-6-12/h7-8,12-14H,2-6,9-11,17H2,1H3/t13-,14-/m1/s1.
What are the key properties of 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone?
1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone has a molecular weight of 290.41 g/mol, XLogP of 1.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4R)-3-amino-4-(2-methylpyrazol-3-yl)pyrrolidin-1-yl]-2-cyclohexylethanone is sourced from PubChem (CID 164635284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).