About 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide
6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide (PubChem CID 164635395) has the molecular formula C16H23N3O3S
and a molecular weight of 337.45 g/mol. Its IUPAC name is 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide.
Molecular Properties
| Compound Name | 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide |
| PubChem CID | 164635395 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide |
| SMILES | C=CC[C@@H]1N(C(=O)c2ccc(S(N)(=O)=O)cn2)CCCC1(C)C |
| InChI | InChI=1S/C16H23N3O3S/c1-4-6-14-16(2,3)9-5-10-19(14)15(20)13-8-7-12(11-18-13)23(17,21)22/h4,7-8,11,14H,1,5-6,9-10H2,2-3H3,(H2,17,21,22)/t14-/m0/s1 |
| InChIKey | LYXXWQGHNOHTPL-AWEZNQCLSA-N |
| XLogP | 1.94 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide?
The IUPAC name of 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide (CID 164635395) is 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide.
What is the SMILES notation for 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide?
The canonical SMILES for 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide is C=CC[C@@H]1N(C(=O)c2ccc(S(N)(=O)=O)cn2)CCCC1(C)C.
What is the InChIKey of 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide?
The InChIKey is LYXXWQGHNOHTPL-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H23N3O3S/c1-4-6-14-16(2,3)9-5-10-19(14)15(20)13-8-7-12(11-18-13)23(17,21)22/h4,7-8,11,14H,1,5-6,9-10H2,2-3H3,(H2,17,21,22)/t14-/m0/s1.
What are the key properties of 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide?
6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide has a molecular weight of 337.45 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S)-3,3-dimethyl-2-prop-2-enylpiperidine-1-carbonyl]pyridine-3-sulfonamide is sourced from PubChem (CID 164635395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).