C12H16F3N5O2 — CID 164635636
(3S)-N-[(1-methyltriazol-4-yl)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide (PubChem CID 164635636) has the molecular formula C12H16F3N5O2 and a molecular weight of 319.29 g/mol. Its IUPAC name is (3S)-N-[(1-methyltriazol-4-yl)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(1-methyltriazol-4-yl)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 164635636 |
| Molecular Formula | C12H16F3N5O2 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (3S)-N-[(1-methyltriazol-4-yl)methyl]-2-oxo-1-(2,2,2-trifluoroethyl)piperidine-3-carboxamide |
| SMILES | Cn1cc(CNC(=O)[C@@H]2CCCN(CC(F)(F)F)C2=O)nn1 |
| InChI | InChI=1S/C12H16F3N5O2/c1-19-6-8(17-18-19)5-16-10(21)9-3-2-4-20(11(9)22)7-12(13,14)15/h6,9H,2-5,7H2,1H3,(H,16,21)/t9-/m0/s1 |
| InChIKey | JMXBPBXRIXYGKD-VIFPVBQESA-N |
| XLogP | 0.23 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|