C13H18ClN3 — CID 164635802
(3aS,7aR)-1-(3-chloro-2-pyridinyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 164635802) has the molecular formula C13H18ClN3 and a molecular weight of 251.76 g/mol. Its IUPAC name is (3aS,7aR)-1-(3-chloro-2-pyridinyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | (3aS,7aR)-1-(3-chloro-2-pyridinyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 164635802 |
| Molecular Formula | C13H18ClN3 |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (3aS,7aR)-1-(3-chloro-2-pyridinyl)-6-methyl-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | CN1CC[C@H]2CCN(c3ncccc3Cl)[C@H]2C1 |
| InChI | InChI=1S/C13H18ClN3/c1-16-7-4-10-5-8-17(12(10)9-16)13-11(14)3-2-6-15-13/h2-3,6,10,12H,4-5,7-9H2,1H3/t10-,12-/m0/s1 |
| InChIKey | ICSLKSPUQPKHTQ-JQWIXIFHSA-N |
| XLogP | 2.27 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |