About 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine
3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine (PubChem CID 164635819) has the molecular formula C16H20N4O3
and a molecular weight of 316.36 g/mol. Its IUPAC name is 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine.
Molecular Properties
| Compound Name | 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine |
| PubChem CID | 164635819 |
| Molecular Formula | C16H20N4O3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine |
| SMILES | COc1nccnc1N[C@H]1CCOC[C@@H]1OCc1ccccn1 |
| InChI | InChI=1S/C16H20N4O3/c1-21-16-15(18-7-8-19-16)20-13-5-9-22-11-14(13)23-10-12-4-2-3-6-17-12/h2-4,6-8,13-14H,5,9-11H2,1H3,(H,18,20)/t13-,14-/m0/s1 |
| InChIKey | HFJBGFQTHXYLHC-KBPBESRZSA-N |
| XLogP | 1.67 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine?
The IUPAC name of 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine (CID 164635819) is 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine.
What is the SMILES notation for 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine?
The canonical SMILES for 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine is COc1nccnc1N[C@H]1CCOC[C@@H]1OCc1ccccn1.
What is the InChIKey of 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine?
The InChIKey is HFJBGFQTHXYLHC-KBPBESRZSA-N. The full InChI is InChI=1S/C16H20N4O3/c1-21-16-15(18-7-8-19-16)20-13-5-9-22-11-14(13)23-10-12-4-2-3-6-17-12/h2-4,6-8,13-14H,5,9-11H2,1H3,(H,18,20)/t13-,14-/m0/s1.
What are the key properties of 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine?
3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine has a molecular weight of 316.36 g/mol, XLogP of 1.67, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-[(3R,4S)-3-(pyridin-2-ylmethoxy)oxan-4-yl]pyrazin-2-amine is sourced from PubChem (CID 164635819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).