About (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide
(2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide (PubChem CID 164635902) has the molecular formula C16H26N4O2
and a molecular weight of 306.41 g/mol. Its IUPAC name is (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide.
Molecular Properties
| Compound Name | (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide |
| PubChem CID | 164635902 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide |
| SMILES | CC(C)[C@@H](C(=O)NCc1nnc(C2CC2)o1)N1CCCCC1 |
| InChI | InChI=1S/C16H26N4O2/c1-11(2)14(20-8-4-3-5-9-20)15(21)17-10-13-18-19-16(22-13)12-6-7-12/h11-12,14H,3-10H2,1-2H3,(H,17,21)/t14-/m0/s1 |
| InChIKey | OBPNACNTRMXPIV-AWEZNQCLSA-N |
| XLogP | 2.07 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide?
The IUPAC name of (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide (CID 164635902) is (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide.
What is the SMILES notation for (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide?
The canonical SMILES for (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide is CC(C)[C@@H](C(=O)NCc1nnc(C2CC2)o1)N1CCCCC1.
What is the InChIKey of (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide?
The InChIKey is OBPNACNTRMXPIV-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H26N4O2/c1-11(2)14(20-8-4-3-5-9-20)15(21)17-10-13-18-19-16(22-13)12-6-7-12/h11-12,14H,3-10H2,1-2H3,(H,17,21)/t14-/m0/s1.
What are the key properties of (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide?
(2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide has a molecular weight of 306.41 g/mol, XLogP of 2.07, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-N-[(5-cyclopropyl-1,3,4-oxadiazol-2-yl)methyl]-3-methyl-2-piperidin-1-ylbutanamide is sourced from PubChem (CID 164635902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).