C22H36N4O3 — CID 164635962
(1,5-dimethylpyrazol-3-yl)-[4-[(3S)-3-(2-methoxyethoxy)-1-azaspiro[3.5]nonan-1-yl]piperidin-1-yl]methanone (PubChem CID 164635962) has the molecular formula C22H36N4O3 and a molecular weight of 404.56 g/mol. Its IUPAC name is (1,5-dimethylpyrazol-3-yl)-[4-[(3S)-3-(2-methoxyethoxy)-1-azaspiro[3.5]nonan-1-yl]piperidin-1-yl]methanone.
| Compound Name | (1,5-dimethylpyrazol-3-yl)-[4-[(3S)-3-(2-methoxyethoxy)-1-azaspiro[3.5]nonan-1-yl]piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 164635962 |
| Molecular Formula | C22H36N4O3 |
| Molecular Weight | 404.56 g/mol |
| Exact Mass | 404.28 |
| IUPAC Name | (1,5-dimethylpyrazol-3-yl)-[4-[(3S)-3-(2-methoxyethoxy)-1-azaspiro[3.5]nonan-1-yl]piperidin-1-yl]methanone |
| SMILES | COCCO[C@H]1CN(C2CCN(C(=O)c3cc(C)n(C)n3)CC2)C12CCCCC2 |
| InChI | InChI=1S/C22H36N4O3/c1-17-15-19(23-24(17)2)21(27)25-11-7-18(8-12-25)26-16-20(29-14-13-28-3)22(26)9-5-4-6-10-22/h15,18,20H,4-14,16H2,1-3H3/t20-/m0/s1 |
| InChIKey | KPSDMTXPZKXBIS-FQEVSTJZSA-N |
| XLogP | 2.38 |
| TPSA | 59.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|