About (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane
(6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane (PubChem CID 164635971) has the molecular formula C17H29N3O
and a molecular weight of 291.44 g/mol. Its IUPAC name is (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane.
Molecular Properties
| Compound Name | (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane |
| PubChem CID | 164635971 |
| Molecular Formula | C17H29N3O |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.23 |
| IUPAC Name | (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane |
| SMILES | CCCn1nc(C)c(CN2C[C@H](C)OC3(CCC3)C2)c1C |
| InChI | InChI=1S/C17H29N3O/c1-5-9-20-15(4)16(14(3)18-20)11-19-10-13(2)21-17(12-19)7-6-8-17/h13H,5-12H2,1-4H3/t13-/m0/s1 |
| InChIKey | DPHHXFZTVXHCEW-ZDUSSCGKSA-N |
| XLogP | 3.05 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane?
The IUPAC name of (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane (CID 164635971) is (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane.
What is the SMILES notation for (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane?
The canonical SMILES for (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane is CCCn1nc(C)c(CN2C[C@H](C)OC3(CCC3)C2)c1C.
What is the InChIKey of (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane?
The InChIKey is DPHHXFZTVXHCEW-ZDUSSCGKSA-N. The full InChI is InChI=1S/C17H29N3O/c1-5-9-20-15(4)16(14(3)18-20)11-19-10-13(2)21-17(12-19)7-6-8-17/h13H,5-12H2,1-4H3/t13-/m0/s1.
What are the key properties of (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane?
(6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane has a molecular weight of 291.44 g/mol, XLogP of 3.05, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6S)-8-[(3,5-dimethyl-1-propylpyrazol-4-yl)methyl]-6-methyl-5-oxa-8-azaspiro[3.5]nonane is sourced from PubChem (CID 164635971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).