C16H28N2O3 — CID 164636304
N-[(2R,3S)-2-ethenyloxan-3-yl]-4-(2-hydroxyethyl)azepane-1-carboxamide (PubChem CID 164636304) has the molecular formula C16H28N2O3 and a molecular weight of 296.41 g/mol. Its IUPAC name is N-[(2R,3S)-2-ethenyloxan-3-yl]-4-(2-hydroxyethyl)azepane-1-carboxamide.
| Compound Name | N-[(2R,3S)-2-ethenyloxan-3-yl]-4-(2-hydroxyethyl)azepane-1-carboxamide |
|---|---|
| PubChem CID | 164636304 |
| Molecular Formula | C16H28N2O3 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N-[(2R,3S)-2-ethenyloxan-3-yl]-4-(2-hydroxyethyl)azepane-1-carboxamide |
| SMILES | C=C[C@H]1OCCC[C@@H]1NC(=O)N1CCCC(CCO)CC1 |
| InChI | InChI=1S/C16H28N2O3/c1-2-15-14(6-4-12-21-15)17-16(20)18-9-3-5-13(7-10-18)8-11-19/h2,13-15,19H,1,3-12H2,(H,17,20)/t13?,14-,15+/m0/s1 |
| InChIKey | REFCCSOGLKJBNB-NOYMGPGASA-N |
| XLogP | 1.91 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|