C17H24N2O2S — CID 164636350
1-[(7S)-7-piperidin-1-yl-5-oxa-2-azaspiro[3.4]octan-2-yl]-2-thiophen-3-ylethanone (PubChem CID 164636350) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[(7S)-7-piperidin-1-yl-5-oxa-2-azaspiro[3.4]octan-2-yl]-2-thiophen-3-ylethanone.
| Compound Name | 1-[(7S)-7-piperidin-1-yl-5-oxa-2-azaspiro[3.4]octan-2-yl]-2-thiophen-3-ylethanone |
|---|---|
| PubChem CID | 164636350 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[(7S)-7-piperidin-1-yl-5-oxa-2-azaspiro[3.4]octan-2-yl]-2-thiophen-3-ylethanone |
| SMILES | O=C(Cc1ccsc1)N1CC2(C[C@H](N3CCCCC3)CO2)C1 |
| InChI | InChI=1S/C17H24N2O2S/c20-16(8-14-4-7-22-11-14)19-12-17(13-19)9-15(10-21-17)18-5-2-1-3-6-18/h4,7,11,15H,1-3,5-6,8-10,12-13H2/t15-/m0/s1 |
| InChIKey | FYYVTWAGFFVRIO-HNNXBMFYSA-N |
| XLogP | 2.15 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |