About (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine
(3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine (PubChem CID 164636406) has the molecular formula C17H31N3O2S
and a molecular weight of 341.52 g/mol. Its IUPAC name is (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine.
Molecular Properties
| Compound Name | (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine |
| PubChem CID | 164636406 |
| Molecular Formula | C17H31N3O2S |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine |
| SMILES | CCc1nccn1[C@H]1CCCN(S(=O)(=O)CCCC(C)(C)C)C1 |
| InChI | InChI=1S/C17H31N3O2S/c1-5-16-18-10-12-20(16)15-8-6-11-19(14-15)23(21,22)13-7-9-17(2,3)4/h10,12,15H,5-9,11,13-14H2,1-4H3/t15-/m0/s1 |
| InChIKey | GHPJJMIPSYAACW-HNNXBMFYSA-N |
| XLogP | 3.24 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine?
The IUPAC name of (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine (CID 164636406) is (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine.
What is the SMILES notation for (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine?
The canonical SMILES for (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine is CCc1nccn1[C@H]1CCCN(S(=O)(=O)CCCC(C)(C)C)C1.
What is the InChIKey of (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine?
The InChIKey is GHPJJMIPSYAACW-HNNXBMFYSA-N. The full InChI is InChI=1S/C17H31N3O2S/c1-5-16-18-10-12-20(16)15-8-6-11-19(14-15)23(21,22)13-7-9-17(2,3)4/h10,12,15H,5-9,11,13-14H2,1-4H3/t15-/m0/s1.
What are the key properties of (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine?
(3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine has a molecular weight of 341.52 g/mol, XLogP of 3.24, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1-(4,4-dimethylpentylsulfonyl)-3-(2-ethylimidazol-1-yl)piperidine is sourced from PubChem (CID 164636406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).