C15H24N4O2 — CID 164636529
1-[(2R,3S)-2-ethyloxolan-3-yl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethyl)urea (PubChem CID 164636529) has the molecular formula C15H24N4O2 and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[(2R,3S)-2-ethyloxolan-3-yl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethyl)urea.
| Compound Name | 1-[(2R,3S)-2-ethyloxolan-3-yl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethyl)urea |
|---|---|
| PubChem CID | 164636529 |
| Molecular Formula | C15H24N4O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 1-[(2R,3S)-2-ethyloxolan-3-yl]-3-(5,6,7,8-tetrahydroimidazo[1,2-a]pyridin-8-ylmethyl)urea |
| SMILES | CC[C@H]1OCC[C@@H]1NC(=O)NCC1CCCn2ccnc21 |
| InChI | InChI=1S/C15H24N4O2/c1-2-13-12(5-9-21-13)18-15(20)17-10-11-4-3-7-19-8-6-16-14(11)19/h6,8,11-13H,2-5,7,9-10H2,1H3,(H2,17,18,20)/t11?,12-,13+/m0/s1 |
| InChIKey | PHNSRSDQIBTEJO-LWNNLKQOSA-N |
| XLogP | 1.63 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |