About N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide
N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide (PubChem CID 164636592) has the molecular formula C12H23N3O2S2
and a molecular weight of 305.47 g/mol. Its IUPAC name is N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide |
| PubChem CID | 164636592 |
| Molecular Formula | C12H23N3O2S2 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC[C@H](C)NCc1csc(CC)n1 |
| InChI | InChI=1S/C12H23N3O2S2/c1-4-6-19(16,17)14-7-10(3)13-8-11-9-18-12(5-2)15-11/h9-10,13-14H,4-8H2,1-3H3/t10-/m0/s1 |
| InChIKey | CMAUZZQFZDMHCN-JTQLQIEISA-N |
| XLogP | 1.51 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide?
The IUPAC name of N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide (CID 164636592) is N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide.
What is the SMILES notation for N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide?
The canonical SMILES for N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide is CCCS(=O)(=O)NC[C@H](C)NCc1csc(CC)n1.
What is the InChIKey of N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide?
The InChIKey is CMAUZZQFZDMHCN-JTQLQIEISA-N. The full InChI is InChI=1S/C12H23N3O2S2/c1-4-6-19(16,17)14-7-10(3)13-8-11-9-18-12(5-2)15-11/h9-10,13-14H,4-8H2,1-3H3/t10-/m0/s1.
What are the key properties of N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide?
N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide has a molecular weight of 305.47 g/mol, XLogP of 1.51, 9 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S)-2-[(2-ethyl-1,3-thiazol-4-yl)methylamino]propyl]propane-1-sulfonamide is sourced from PubChem (CID 164636592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).