About N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide
N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide (PubChem CID 164636822) has the molecular formula C11H17F2NO3
and a molecular weight of 249.26 g/mol. Its IUPAC name is N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide.
Molecular Properties
| Compound Name | N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide |
| PubChem CID | 164636822 |
| Molecular Formula | C11H17F2NO3 |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCCC(F)(F)[C@H]1O)C1(O)CCC1 |
| InChI | InChI=1S/C11H17F2NO3/c12-11(13)6-1-3-7(8(11)15)14-9(16)10(17)4-2-5-10/h7-8,15,17H,1-6H2,(H,14,16)/t7-,8+/m1/s1 |
| InChIKey | PQNUOVNYFCATNM-SFYZADRCSA-N |
| XLogP | 0.57 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide?
The IUPAC name of N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide (CID 164636822) is N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide.
What is the SMILES notation for N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide?
The canonical SMILES for N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide is O=C(N[C@@H]1CCCC(F)(F)[C@H]1O)C1(O)CCC1.
What is the InChIKey of N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide?
The InChIKey is PQNUOVNYFCATNM-SFYZADRCSA-N. The full InChI is InChI=1S/C11H17F2NO3/c12-11(13)6-1-3-7(8(11)15)14-9(16)10(17)4-2-5-10/h7-8,15,17H,1-6H2,(H,14,16)/t7-,8+/m1/s1.
What are the key properties of N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide?
N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide has a molecular weight of 249.26 g/mol, XLogP of 0.57, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1R,2S)-3,3-difluoro-2-hydroxycyclohexyl]-1-hydroxycyclobutane-1-carboxamide is sourced from PubChem (CID 164636822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).