About (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine
(1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine (PubChem CID 164636941) has the molecular formula C10H13BrClN3
and a molecular weight of 290.59 g/mol. Its IUPAC name is (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine.
Molecular Properties
| Compound Name | (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine |
| PubChem CID | 164636941 |
| Molecular Formula | C10H13BrClN3 |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine |
| SMILES | N[C@@H](CNc1ncc(Cl)cc1Br)C1CC1 |
| InChI | InChI=1S/C10H13BrClN3/c11-8-3-7(12)4-14-10(8)15-5-9(13)6-1-2-6/h3-4,6,9H,1-2,5,13H2,(H,14,15)/t9-/m0/s1 |
| InChIKey | GAVLPPVZIOYCCR-VIFPVBQESA-N |
| XLogP | 2.65 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine?
The IUPAC name of (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine (CID 164636941) is (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine.
What is the SMILES notation for (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine?
The canonical SMILES for (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine is N[C@@H](CNc1ncc(Cl)cc1Br)C1CC1.
What is the InChIKey of (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine?
The InChIKey is GAVLPPVZIOYCCR-VIFPVBQESA-N. The full InChI is InChI=1S/C10H13BrClN3/c11-8-3-7(12)4-14-10(8)15-5-9(13)6-1-2-6/h3-4,6,9H,1-2,5,13H2,(H,14,15)/t9-/m0/s1.
What are the key properties of (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine?
(1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine has a molecular weight of 290.59 g/mol, XLogP of 2.65, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-N'-(3-bromo-5-chloro-2-pyridinyl)-1-cyclopropylethane-1,2-diamine is sourced from PubChem (CID 164636941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).