About 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea
1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea (PubChem CID 164636962) has the molecular formula C16H22N2O4
and a molecular weight of 306.36 g/mol. Its IUPAC name is 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea.
Molecular Properties
| Compound Name | 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea |
| PubChem CID | 164636962 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea |
| SMILES | C=C(CNC(=O)N[C@H](CO)CC1OCCO1)c1ccccc1 |
| InChI | InChI=1S/C16H22N2O4/c1-12(13-5-3-2-4-6-13)10-17-16(20)18-14(11-19)9-15-21-7-8-22-15/h2-6,14-15,19H,1,7-11H2,(H2,17,18,20)/t14-/m0/s1 |
| InChIKey | CAIZCQZSVJXIDD-AWEZNQCLSA-N |
| XLogP | 1.12 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea?
The IUPAC name of 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea (CID 164636962) is 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea.
What is the SMILES notation for 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea?
The canonical SMILES for 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea is C=C(CNC(=O)N[C@H](CO)CC1OCCO1)c1ccccc1.
What is the InChIKey of 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea?
The InChIKey is CAIZCQZSVJXIDD-AWEZNQCLSA-N. The full InChI is InChI=1S/C16H22N2O4/c1-12(13-5-3-2-4-6-13)10-17-16(20)18-14(11-19)9-15-21-7-8-22-15/h2-6,14-15,19H,1,7-11H2,(H2,17,18,20)/t14-/m0/s1.
What are the key properties of 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea?
1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea has a molecular weight of 306.36 g/mol, XLogP of 1.12, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S)-1-(1,3-dioxolan-2-yl)-3-hydroxypropan-2-yl]-3-(2-phenylprop-2-enyl)urea is sourced from PubChem (CID 164636962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).