About (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane
(5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane (PubChem CID 164637020) has the molecular formula C17H28N4
and a molecular weight of 288.44 g/mol. Its IUPAC name is (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane.
Molecular Properties
| Compound Name | (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane |
| PubChem CID | 164637020 |
| Molecular Formula | C17H28N4 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane |
| SMILES | CN1CC[C@]2(CCN(Cc3cnc(C(C)(C)C)nc3)C2)C1 |
| InChI | InChI=1S/C17H28N4/c1-16(2,3)15-18-9-14(10-19-15)11-21-8-6-17(13-21)5-7-20(4)12-17/h9-10H,5-8,11-13H2,1-4H3/t17-/m0/s1 |
| InChIKey | NEWJGBCZSCKEKC-KRWDZBQOSA-N |
| XLogP | 2.30 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane?
The IUPAC name of (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane (CID 164637020) is (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane.
What is the SMILES notation for (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane?
The canonical SMILES for (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane is CN1CC[C@]2(CCN(Cc3cnc(C(C)(C)C)nc3)C2)C1.
What is the InChIKey of (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane?
The InChIKey is NEWJGBCZSCKEKC-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H28N4/c1-16(2,3)15-18-9-14(10-19-15)11-21-8-6-17(13-21)5-7-20(4)12-17/h9-10H,5-8,11-13H2,1-4H3/t17-/m0/s1.
What are the key properties of (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane?
(5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane has a molecular weight of 288.44 g/mol, XLogP of 2.30, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-2-[(2-tert-butylpyrimidin-5-yl)methyl]-7-methyl-2,7-diazaspiro[4.4]nonane is sourced from PubChem (CID 164637020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).