About 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine
5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine (PubChem CID 164637376) has the molecular formula C17H31N5
and a molecular weight of 305.47 g/mol. Its IUPAC name is 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine |
| PubChem CID | 164637376 |
| Molecular Formula | C17H31N5 |
| Molecular Weight | 305.47 g/mol |
| Exact Mass | 305.26 |
| IUPAC Name | 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine |
| SMILES | CCCNc1ncc(CN2C[C@H](CCC)[C@@H](N(C)C)C2)cn1 |
| InChI | InChI=1S/C17H31N5/c1-5-7-15-12-22(13-16(15)21(3)4)11-14-9-19-17(20-10-14)18-8-6-2/h9-10,15-16H,5-8,11-13H2,1-4H3,(H,18,19,20)/t15-,16-/m0/s1 |
| InChIKey | ZPOAHXNNTFKNHG-HOTGVXAUSA-N |
| XLogP | 2.46 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.47 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine?
The IUPAC name of 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine (CID 164637376) is 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine.
What is the SMILES notation for 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine?
The canonical SMILES for 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine is CCCNc1ncc(CN2C[C@H](CCC)[C@@H](N(C)C)C2)cn1.
What is the InChIKey of 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine?
The InChIKey is ZPOAHXNNTFKNHG-HOTGVXAUSA-N. The full InChI is InChI=1S/C17H31N5/c1-5-7-15-12-22(13-16(15)21(3)4)11-14-9-19-17(20-10-14)18-8-6-2/h9-10,15-16H,5-8,11-13H2,1-4H3,(H,18,19,20)/t15-,16-/m0/s1.
What are the key properties of 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine?
5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine has a molecular weight of 305.47 g/mol, XLogP of 2.46, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[(3R,4S)-3-(dimethylamino)-4-propylpyrrolidin-1-yl]methyl]-N-propylpyrimidin-2-amine is sourced from PubChem (CID 164637376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).