About 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide
2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide (PubChem CID 164637394) has the molecular formula C11H16N2O3
and a molecular weight of 224.26 g/mol. Its IUPAC name is 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide.
Molecular Properties
| Compound Name | 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide |
| PubChem CID | 164637394 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide |
| SMILES | O=C(C[C@H]1CCCOC1)NCc1ccno1 |
| InChI | InChI=1S/C11H16N2O3/c14-11(6-9-2-1-5-15-8-9)12-7-10-3-4-13-16-10/h3-4,9H,1-2,5-8H2,(H,12,14)/t9-/m1/s1 |
| InChIKey | LHSGSEROROFETD-SECBINFHSA-N |
| XLogP | 1.11 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide?
The IUPAC name of 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide (CID 164637394) is 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide.
What is the SMILES notation for 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide?
The canonical SMILES for 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide is O=C(C[C@H]1CCCOC1)NCc1ccno1.
What is the InChIKey of 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide?
The InChIKey is LHSGSEROROFETD-SECBINFHSA-N. The full InChI is InChI=1S/C11H16N2O3/c14-11(6-9-2-1-5-15-8-9)12-7-10-3-4-13-16-10/h3-4,9H,1-2,5-8H2,(H,12,14)/t9-/m1/s1.
What are the key properties of 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide?
2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide has a molecular weight of 224.26 g/mol, XLogP of 1.11, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3R)-oxan-3-yl]-N-(1,2-oxazol-5-ylmethyl)acetamide is sourced from PubChem (CID 164637394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).