About [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol
[(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol (PubChem CID 164637421) has the molecular formula C17H20F2N4O
and a molecular weight of 334.37 g/mol. Its IUPAC name is [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol |
| PubChem CID | 164637421 |
| Molecular Formula | C17H20F2N4O |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol |
| SMILES | OC[C@H]1CN(Cc2ccc(F)cn2)CCN1Cc1ccc(F)cn1 |
| InChI | InChI=1S/C17H20F2N4O/c18-13-1-3-15(20-7-13)9-22-5-6-23(17(11-22)12-24)10-16-4-2-14(19)8-21-16/h1-4,7-8,17,24H,5-6,9-12H2/t17-/m1/s1 |
| InChIKey | HEQIYLWUOUYWRR-QGZVFWFLSA-N |
| XLogP | 1.43 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol?
The IUPAC name of [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol (CID 164637421) is [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol.
What is the SMILES notation for [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol?
The canonical SMILES for [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol is OC[C@H]1CN(Cc2ccc(F)cn2)CCN1Cc1ccc(F)cn1.
What is the InChIKey of [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol?
The InChIKey is HEQIYLWUOUYWRR-QGZVFWFLSA-N. The full InChI is InChI=1S/C17H20F2N4O/c18-13-1-3-15(20-7-13)9-22-5-6-23(17(11-22)12-24)10-16-4-2-14(19)8-21-16/h1-4,7-8,17,24H,5-6,9-12H2/t17-/m1/s1.
What are the key properties of [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol?
[(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol has a molecular weight of 334.37 g/mol, XLogP of 1.43, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-1,4-bis[(5-fluoro-2-pyridinyl)methyl]piperazin-2-yl]methanol is sourced from PubChem (CID 164637421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).