C19H37N3O — CID 164637520
(4S)-4-(4-methylpiperazin-1-yl)-N-[[1-(2-methylpropyl)cyclobutyl]methyl]pentanamide (PubChem CID 164637520) has the molecular formula C19H37N3O and a molecular weight of 323.53 g/mol. Its IUPAC name is (4S)-4-(4-methylpiperazin-1-yl)-N-[[1-(2-methylpropyl)cyclobutyl]methyl]pentanamide.
| Compound Name | (4S)-4-(4-methylpiperazin-1-yl)-N-[[1-(2-methylpropyl)cyclobutyl]methyl]pentanamide |
|---|---|
| PubChem CID | 164637520 |
| Molecular Formula | C19H37N3O |
| Molecular Weight | 323.53 g/mol |
| Exact Mass | 323.29 |
| IUPAC Name | (4S)-4-(4-methylpiperazin-1-yl)-N-[[1-(2-methylpropyl)cyclobutyl]methyl]pentanamide |
| SMILES | CC(C)CC1(CNC(=O)CC[C@H](C)N2CCN(C)CC2)CCC1 |
| InChI | InChI=1S/C19H37N3O/c1-16(2)14-19(8-5-9-19)15-20-18(23)7-6-17(3)22-12-10-21(4)11-13-22/h16-17H,5-15H2,1-4H3,(H,20,23)/t17-/m0/s1 |
| InChIKey | BRTGMCFSSACVNH-KRWDZBQOSA-N |
| XLogP | 2.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.53 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |