C8H12N2O2S — CID 164637602
2-methoxy-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]acetamide (PubChem CID 164637602) has the molecular formula C8H12N2O2S and a molecular weight of 200.26 g/mol. Its IUPAC name is 2-methoxy-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]acetamide.
| Compound Name | 2-methoxy-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 164637602 |
| Molecular Formula | C8H12N2O2S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.06 |
| IUPAC Name | 2-methoxy-N-[(1S)-1-(1,3-thiazol-5-yl)ethyl]acetamide |
| SMILES | COCC(=O)N[C@@H](C)c1cncs1 |
| InChI | InChI=1S/C8H12N2O2S/c1-6(7-3-9-5-13-7)10-8(11)4-12-2/h3,5-6H,4H2,1-2H3,(H,10,11)/t6-/m0/s1 |
| InChIKey | KHULHSBNXIVGQJ-LURJTMIESA-N |
| XLogP | 0.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |