About (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide
(1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide (PubChem CID 164637617) has the molecular formula C10H13F2N3O
and a molecular weight of 229.23 g/mol. Its IUPAC name is (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide.
Molecular Properties
| Compound Name | (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide |
| PubChem CID | 164637617 |
| Molecular Formula | C10H13F2N3O |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide |
| SMILES | Cn1cc(NC(=O)[C@H]2CCC(F)(F)C2)cn1 |
| InChI | InChI=1S/C10H13F2N3O/c1-15-6-8(5-13-15)14-9(16)7-2-3-10(11,12)4-7/h5-7H,2-4H2,1H3,(H,14,16)/t7-/m0/s1 |
| InChIKey | HXNQBKDPKUKZNZ-ZETCQYMHSA-N |
| XLogP | 1.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide?
The IUPAC name of (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide (CID 164637617) is (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide.
What is the SMILES notation for (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide?
The canonical SMILES for (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide is Cn1cc(NC(=O)[C@H]2CCC(F)(F)C2)cn1.
What is the InChIKey of (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide?
The InChIKey is HXNQBKDPKUKZNZ-ZETCQYMHSA-N. The full InChI is InChI=1S/C10H13F2N3O/c1-15-6-8(5-13-15)14-9(16)7-2-3-10(11,12)4-7/h5-7H,2-4H2,1H3,(H,14,16)/t7-/m0/s1.
What are the key properties of (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide?
(1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide has a molecular weight of 229.23 g/mol, XLogP of 1.79, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-3,3-difluoro-N-(1-methylpyrazol-4-yl)cyclopentane-1-carboxamide is sourced from PubChem (CID 164637617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).