C12H23NO3S — CID 164638158
(4R)-1-(cyclopropylmethylsulfonyl)-6,6-dimethylazepan-4-ol (PubChem CID 164638158) has the molecular formula C12H23NO3S and a molecular weight of 261.39 g/mol. Its IUPAC name is (4R)-1-(cyclopropylmethylsulfonyl)-6,6-dimethylazepan-4-ol.
| Compound Name | (4R)-1-(cyclopropylmethylsulfonyl)-6,6-dimethylazepan-4-ol |
|---|---|
| PubChem CID | 164638158 |
| Molecular Formula | C12H23NO3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | (4R)-1-(cyclopropylmethylsulfonyl)-6,6-dimethylazepan-4-ol |
| SMILES | CC1(C)C[C@@H](O)CCN(S(=O)(=O)CC2CC2)C1 |
| InChI | InChI=1S/C12H23NO3S/c1-12(2)7-11(14)5-6-13(9-12)17(15,16)8-10-3-4-10/h10-11,14H,3-9H2,1-2H3/t11-/m0/s1 |
| InChIKey | JHBYALULBQOGKA-NSHDSACASA-N |
| XLogP | 1.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |