About (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine
(1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine (PubChem CID 164638202) has the molecular formula C13H20N4S
and a molecular weight of 264.40 g/mol. Its IUPAC name is (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine.
Molecular Properties
| Compound Name | (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine |
| PubChem CID | 164638202 |
| Molecular Formula | C13H20N4S |
| Molecular Weight | 264.40 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine |
| SMILES | C[C@H](NCc1cnc(C(C)(C)C)s1)c1cn[nH]c1 |
| InChI | InChI=1S/C13H20N4S/c1-9(10-5-16-17-6-10)14-7-11-8-15-12(18-11)13(2,3)4/h5-6,8-9,14H,7H2,1-4H3,(H,16,17)/t9-/m0/s1 |
| InChIKey | ZRWQGNRXPYBDNL-VIFPVBQESA-N |
| XLogP | 3.01 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.40 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine?
The IUPAC name of (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine (CID 164638202) is (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine.
What is the SMILES notation for (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine?
The canonical SMILES for (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine is C[C@H](NCc1cnc(C(C)(C)C)s1)c1cn[nH]c1.
What is the InChIKey of (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine?
The InChIKey is ZRWQGNRXPYBDNL-VIFPVBQESA-N. The full InChI is InChI=1S/C13H20N4S/c1-9(10-5-16-17-6-10)14-7-11-8-15-12(18-11)13(2,3)4/h5-6,8-9,14H,7H2,1-4H3,(H,16,17)/t9-/m0/s1.
What are the key properties of (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine?
(1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine has a molecular weight of 264.40 g/mol, XLogP of 3.01, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-1-(1H-pyrazol-4-yl)ethanamine is sourced from PubChem (CID 164638202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).