About 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone
1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone (PubChem CID 164638212) has the molecular formula C18H18FNO2
and a molecular weight of 299.35 g/mol. Its IUPAC name is 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone.
Molecular Properties
| Compound Name | 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone |
| PubChem CID | 164638212 |
| Molecular Formula | C18H18FNO2 |
| Molecular Weight | 299.35 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone |
| SMILES | O=C(C(c1ccccc1)c1ccccc1)N1C[C@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C18H18FNO2/c19-15-11-20(12-16(15)21)18(22)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-17,21H,11-12H2/t15-,16-/m0/s1 |
| InChIKey | XZXUOUGPYYQLKQ-HOTGVXAUSA-N |
| XLogP | 2.36 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone?
The IUPAC name of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone (CID 164638212) is 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone.
What is the SMILES notation for 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone?
The canonical SMILES for 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone is O=C(C(c1ccccc1)c1ccccc1)N1C[C@H](O)[C@@H](F)C1.
What is the InChIKey of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone?
The InChIKey is XZXUOUGPYYQLKQ-HOTGVXAUSA-N. The full InChI is InChI=1S/C18H18FNO2/c19-15-11-20(12-16(15)21)18(22)17(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15-17,21H,11-12H2/t15-,16-/m0/s1.
What are the key properties of 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone?
1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone has a molecular weight of 299.35 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3S,4S)-3-fluoro-4-hydroxypyrrolidin-1-yl]-2,2-diphenylethanone is sourced from PubChem (CID 164638212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).