C16H26N4O2 — CID 164638257
2-N,4-N-bis[(1S,2S)-2-methoxycyclopentyl]pyrimidine-2,4-diamine (PubChem CID 164638257) has the molecular formula C16H26N4O2 and a molecular weight of 306.41 g/mol. Its IUPAC name is 2-N,4-N-bis[(1S,2S)-2-methoxycyclopentyl]pyrimidine-2,4-diamine.
| Compound Name | 2-N,4-N-bis[(1S,2S)-2-methoxycyclopentyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 164638257 |
| Molecular Formula | C16H26N4O2 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 2-N,4-N-bis[(1S,2S)-2-methoxycyclopentyl]pyrimidine-2,4-diamine |
| SMILES | CO[C@H]1CCC[C@@H]1Nc1ccnc(N[C@H]2CCC[C@@H]2OC)n1 |
| InChI | InChI=1S/C16H26N4O2/c1-21-13-7-3-5-11(13)18-15-9-10-17-16(20-15)19-12-6-4-8-14(12)22-2/h9-14H,3-8H2,1-2H3,(H2,17,18,19,20)/t11-,12-,13-,14-/m0/s1 |
| InChIKey | BKWQQAYWEUHMOR-XUXIUFHCSA-N |
| XLogP | 2.44 |
| TPSA | 68.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |