C16H20N4O2 — CID 164638285
(6S)-N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide (PubChem CID 164638285) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is (6S)-N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide.
| Compound Name | (6S)-N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide |
|---|---|
| PubChem CID | 164638285 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (6S)-N-[(1,6-dimethyl-2-oxo-3-pyridinyl)methyl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine-6-carboxamide |
| SMILES | Cc1ccc(CNC(=O)[C@H]2CCc3cncn3C2)c(=O)n1C |
| InChI | InChI=1S/C16H20N4O2/c1-11-3-4-12(16(22)19(11)2)7-18-15(21)13-5-6-14-8-17-10-20(14)9-13/h3-4,8,10,13H,5-7,9H2,1-2H3,(H,18,21)/t13-/m0/s1 |
| InChIKey | KLCZXNNQFSQISS-ZDUSSCGKSA-N |
| XLogP | 0.77 |
| TPSA | 68.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |